Compound Information | SONAR Target prediction | Name: | YS-035 hydrochloride | Unique Identifier: | LOPAC 00162 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C21ClH30NO4 | Molecular Weight: | 365.682 g/mol | X log p: | 14.329 (online calculus) | Lipinksi Failures | 1 | TPSA | 40.16 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 10 | Canonical Smiles: | Cl.COc1ccc(CCN(C)CCc2ccc(OC)c(OC)c2)cc1OC | Class: | Ca2+ Channel | Action: | Blocker | Selectivity: | L-type |
Species: |
4932 |
Condition: |
WHI5 |
Replicates: |
2 |
Raw OD Value: r im |
0.6311±0.00127279 |
Normalized OD Score: sc h |
1.0185±0.00600265 |
Z-Score: |
0.5699±0.248708 |
p-Value: |
0.5747 |
Z-Factor: |
-3.61809 |
Fitness Defect: |
0.5539 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 16|B11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-04-20 YYYY-MM-DD | Plate CH Control (+): | 0.047475±0.00156 | Plate DMSO Control (-): | 0.666825±0.09333 | Plate Z-Factor: | 0.8067 |
| png ps pdf |
215356 |
2-(3,4-dimethoxyphenyl)-N-phenethyl-ethanamine |
3048686 |
2-(3,4-dimethoxyphenyl)-N-phenethyl-ethanamine hydrobromide |
6917841 |
2-(3,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-ethanamine hydrochloride |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 3209 | Additional Members: 11 | Rows returned: 0 | |
|