| Compound Information | SONAR Target prediction |  | Name: | YS-035 hydrochloride |  | Unique Identifier: | LOPAC 00162  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C21ClH30NO4 |  | Molecular Weight: | 365.682 g/mol |  | X log p: | 14.329  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 40.16 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 5 |  | Rotatable Bond Count: | 10 |  | Canonical Smiles: | Cl.COc1ccc(CCN(C)CCc2ccc(OC)c(OC)c2)cc1OC |  | Class: | Ca2+ Channel |  | Action: | Blocker |  | Selectivity: | L-type |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		NOP13 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7135±0.0314663 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0191±0.0184516 | 
	 
	
		| Z-Score: | 
		0.8408±0.740162 | 
	 
	
		| p-Value: | 
		0.46174 | 
	 
	
		| Z-Factor: | 
		-4.80898 | 
	 
	
		| Fitness Defect: | 
		0.7728 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Lopac |  | Plate Number and Position: | 16|B11 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 0.00 Celcius |  | Date: | 2005-04-22 YYYY-MM-DD |  | Plate CH Control (+): | 0.046799999999999994±0.00071 |  | Plate DMSO Control (-): | 0.67905±0.05700 |  | Plate Z-Factor: | 0.8396 |  
  |  png ps pdf |  
 
 
	
		| 215356 | 
		2-(3,4-dimethoxyphenyl)-N-phenethyl-ethanamine | 
	 
	
		| 3048686 | 
		2-(3,4-dimethoxyphenyl)-N-phenethyl-ethanamine hydrobromide | 
	 
	
		| 6917841 | 
		2-(3,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-ethanamine hydrochloride | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 3209 | Additional Members: 11 | Rows returned: 0 |  |  
  
 |