Compound Information | SONAR Target prediction | Name: | YS-035 hydrochloride | Unique Identifier: | LOPAC 00162 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C21ClH30NO4 | Molecular Weight: | 365.682 g/mol | X log p: | 14.329 (online calculus) | Lipinksi Failures | 1 | TPSA | 40.16 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 10 | Canonical Smiles: | Cl.COc1ccc(CCN(C)CCc2ccc(OC)c(OC)c2)cc1OC | Class: | Ca2+ Channel | Action: | Blocker | Selectivity: | L-type |
Species: |
4932 |
Condition: |
BY4741 |
Replicates: |
8 |
Raw OD Value: r im |
0.7443±0.05486 |
Normalized OD Score: sc h |
0.9968±0.0121065 |
Z-Score: |
-0.1492±0.394801 |
p-Value: |
0.852222 |
Z-Factor: |
-21.86 |
Fitness Defect: |
0.1599 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 16|B11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.80 Celcius | Date: | 2005-04-07 YYYY-MM-DD | Plate CH Control (+): | 0.04744375000000002±0.00149 | Plate DMSO Control (-): | 0.7487312500000001±0.03169 | Plate Z-Factor: | 0.8821 |
| png ps pdf |
215356 |
2-(3,4-dimethoxyphenyl)-N-phenethyl-ethanamine |
3048686 |
2-(3,4-dimethoxyphenyl)-N-phenethyl-ethanamine hydrobromide |
6917841 |
2-(3,4-dimethoxyphenyl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-N-methyl-ethanamine hydrochloride |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 3209 | Additional Members: 11 | Rows returned: 0 | |
|