Compound Information | SONAR Target prediction | Name: | L(-)-Norepinephrine bitartrate | Unique Identifier: | LOPAC 00130 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C12H17NO9 | Molecular Weight: | 303.138 g/mol | X log p: | 5.47 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 2 | Canonical Smiles: | NCC(O)c1ccc(O)c(O)c1.OC(C(O)C(O)=O)C(O)=O | Class: | Adrenoceptor | Action: | Agonist | Selectivity: | alpha, beta1 |
Species: |
4932 |
Condition: |
BY4741 |
Replicates: |
8 |
Raw OD Value: r im |
0.8488±0.111157 |
Normalized OD Score: sc h |
1.0016±0.0100849 |
Z-Score: |
0.0573±0.376767 |
p-Value: |
0.769146 |
Z-Factor: |
-11.6901 |
Fitness Defect: |
0.2625 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 2|B5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.60 Celcius | Date: | 2005-04-07 YYYY-MM-DD | Plate CH Control (+): | 0.046749999999999986±0.00334 | Plate DMSO Control (-): | 0.7916312500000005±0.04022 | Plate Z-Factor: | 0.8778 |
| png ps pdf |
6604057 |
4-[(1R)-2-amino-1-hydroxy-ethyl]benzene-1,2-diol; (2S,3R)-2,3-dihydroxybutanedioic acid |
internal high similarity DBLink | Rows returned: 3 | |
nonactive | Cluster 15753 | Additional Members: 7 | Rows returned: 6 | |
|