| Compound Information | SONAR Target prediction | | Name: | L(-)-Norepinephrine bitartrate | | Unique Identifier: | LOPAC 00130 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C12H17NO9 | | Molecular Weight: | 303.138 g/mol | | X log p: | 5.47 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 2 | | Canonical Smiles: | NCC(O)c1ccc(O)c(O)c1.OC(C(O)C(O)=O)C(O)=O | | Class: | Adrenoceptor | | Action: | Agonist | | Selectivity: | alpha, beta1 |
| Species: |
4932 |
| Condition: |
HOC1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5688±0.00473762 |
| Normalized OD Score: sc h |
1.0229±0.00891557 |
| Z-Score: |
1.0389±0.316168 |
| p-Value: |
0.310814 |
| Z-Factor: |
-1.90167 |
| Fitness Defect: |
1.1686 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 2|B5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.50 Celcius | | Date: | 2005-11-24 YYYY-MM-DD | | Plate CH Control (+): | 0.0387±0.00118 | | Plate DMSO Control (-): | 0.55865±0.01265 | | Plate Z-Factor: | 0.8920 |
| png ps pdf |
| 6604057 |
4-[(1R)-2-amino-1-hydroxy-ethyl]benzene-1,2-diol; (2S,3R)-2,3-dihydroxybutanedioic acid |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 15753 | Additional Members: 7 | Rows returned: 2 | |
|