Compound Information | SONAR Target prediction | Name: | L(-)-Norepinephrine bitartrate | Unique Identifier: | LOPAC 00130 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C12H17NO9 | Molecular Weight: | 303.138 g/mol | X log p: | 5.47 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 2 | Canonical Smiles: | NCC(O)c1ccc(O)c(O)c1.OC(C(O)C(O)=O)C(O)=O | Class: | Adrenoceptor | Action: | Agonist | Selectivity: | alpha, beta1 |
Species: |
4932 |
Condition: |
DEP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6701±0.00254558 |
Normalized OD Score: sc h |
1.0300±0.0129091 |
Z-Score: |
1.2192±0.47486 |
p-Value: |
0.248474 |
Z-Factor: |
-3.09776 |
Fitness Defect: |
1.3924 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 2|B5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.90 Celcius | Date: | 2005-11-16 YYYY-MM-DD | Plate CH Control (+): | 0.03855±0.00129 | Plate DMSO Control (-): | 0.64055±0.02116 | Plate Z-Factor: | 0.8634 |
| png ps pdf |
6604057 |
4-[(1R)-2-amino-1-hydroxy-ethyl]benzene-1,2-diol; (2S,3R)-2,3-dihydroxybutanedioic acid |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 15753 | Additional Members: 7 | Rows returned: 2 | |
|