| Compound Information | SONAR Target prediction |  | Name: | L(-)-Norepinephrine bitartrate |  | Unique Identifier: | LOPAC 00130  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C12H17NO9 |  | Molecular Weight: | 303.138 g/mol |  | X log p: | 5.47  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 2 |  | Canonical Smiles: | NCC(O)c1ccc(O)c(O)c1.OC(C(O)C(O)=O)C(O)=O |  | Class: | Adrenoceptor |  | Action: | Agonist |  | Selectivity: | alpha, beta1 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		GIM3 | 
	 
	
		| Replicates: | 
		4 | 
	 
	
		| Raw OD Value: r im | 
		0.5419±0.0158162 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0091±0.0292387 | 
	 
	
		| Z-Score: | 
		0.1762±0.483062 | 
	 
	
		| p-Value: | 
		0.860206 | 
	 
	
		| Z-Factor: | 
		-3.66238 | 
	 
	
		| Fitness Defect: | 
		0.1506 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Lopac |  | Plate Number and Position: | 2|B5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 27.50 Celcius |  | Date: | 2005-04-08 YYYY-MM-DD |  | Plate CH Control (+): | 0.045725±0.00248 |  | Plate DMSO Control (-): | 0.6999875±0.18996 |  | Plate Z-Factor: | -0.6400 |  
  |  png ps pdf |  
 
 
	
		| 5813 | 
		4-(2-amino-1-hydroxy-ethyl)benzene-1,2-diol; (2R,3R)-2,3-dihydroxybutanedioic acid | 
	 
	
		| 165118 | 
		4-(2-amino-1-hydroxy-ethyl)benzene-1,2-diol; (2R,3R)-2,3-dihydroxybutanedioate | 
	 
	
		| 168929 | 
		4-[(1S)-2-amino-1-hydroxy-ethyl]benzene-1,2-diol; (2R,3R)-2,3-dihydroxybutanedioic acid | 
	 
	
		| 297812 | 
		4-(2-amino-1-hydroxy-ethyl)benzene-1,2-diol; 2,3-dihydroxybutanedioic acid | 
	 
	
		| 517292 | 
		[2-(3,4-dihydroxyphenyl)-2-hydroxy-ethyl]azanium; 2,3,4-trihydroxy-4-oxo-butanoate; hydrate | 
	 
	
		| 3047796 | 
		4-[(1R)-2-amino-1-hydroxy-ethyl]benzene-1,2-diol; (2R,3R)-2,3-dihydroxybutanedioic acid; hydrate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 3 |  |   
 |  active | Cluster 15753 | Additional Members: 7 | Rows returned: 2 |  |   
 
 |