Compound Information | SONAR Target prediction | Name: | (-)-Epinephrine bitartrate | Unique Identifier: | LOPAC 00114 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C13H19NO9 | Molecular Weight: | 315.148 g/mol | X log p: | 6.036 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 3 | Canonical Smiles: | CNCC(O)c1ccc(O)c(O)c1.OC(C(O)C(O)=O)C(O)=O | Class: | Adrenoceptor | Action: | Agonist |
Species: |
4932 |
Condition: |
LGE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.4716±0.020294 |
Normalized OD Score: sc h |
1.0778±0.00742806 |
Z-Score: |
2.6672±0.176847 |
p-Value: |
0.0081263 |
Z-Factor: |
-0.15951 |
Fitness Defect: |
4.8126 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 7|C3 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.90 Celcius | Date: | 2005-11-29 YYYY-MM-DD | Plate CH Control (+): | 0.03875±0.00074 | Plate DMSO Control (-): | 0.4648±0.01018 | Plate Z-Factor: | 0.9091 |
| png ps pdf |
DBLink | Rows returned: 5 | |
5815 |
(2R,3R)-2,3-dihydroxybutanedioic acid; 4-[(1R)-1-hydroxy-2-methylamino-ethyl]benzene-1,2-diol |
89249 |
(2R,3R)-2,3-dihydroxybutanedioic acid; 4-(1-hydroxy-2-methylamino-ethyl)benzene-1,2-diol |
5702049 |
2,3-dihydroxybutanedioic acid; 4-[(1S)-1-hydroxy-2-methylamino-ethyl]benzene-1,2-diol |
6604103 |
(2R,3S)-2,3-dihydroxybutanedioic acid; 4-[(1R)-1-hydroxy-2-methylamino-ethyl]benzene-1,2-diol |
6852374 |
2,3-dihydroxybutanedioic acid; 4-[(1R)-1-hydroxy-2-methylamino-ethyl]benzene-1,2-diol |
internal high similarity DBLink | Rows returned: 5 | |
active | Cluster 1040 | Additional Members: 10 | Rows returned: 1 | |
|