| 
 | Compound Information | SONAR Target prediction |  | Name: | R(-)-Isoproterenol (+)-bitartrate |  | Unique Identifier: | LOPAC 00113 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C15H23NO9 |  | Molecular Weight: | 339.17 g/mol |  | X log p: | 6.006  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 0 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC(C)NCC(O)c1ccc(O)c(O)c1.OC(C(O)C(O)=O)C(O)=O |  | Class: | Adrenoceptor |  | Action: | Agonist |  | Selectivity: | beta | 
 
 
	
		| Species: | 4932 |  
		| Condition: | SAP30 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.8122±0.0104652 |  
		| Normalized OD Score: sc h | 1.0001±0.00168968 |  
		| Z-Score: | 0.0030±0.145343 |  
		| p-Value: | 0.918144 |  
		| Z-Factor: | -65.6771 |  
		| Fitness Defect: | 0.0854 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Lopac |  | Plate Number and Position: | 8|H11 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.20 Celcius |  | Date: | 2005-11-18 YYYY-MM-DD |  | Plate CH Control (+): | 0.0383±0.00273 |  | Plate DMSO Control (-): | 0.7941±0.01038 |  | Plate Z-Factor: | 0.9431 | 
 |  png ps
 pdf
 | 
 
 | DBLink  | Rows returned: 5 |  | 
 
	
		| 26792 | 2,3-dihydroxybutanedioic acid; 4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol |  
		| 160420 | (2R,3R)-2,3-dihydroxybutanedioic acid; 4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol |  
		| 2724018 | (2R,3R)-2,3-dihydroxybutanedioic acid; 4-[(1S)-1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol |  
		| 6604115 | (2R,3S)-2,3-dihydroxybutanedioic acid; 4-[(1R)-1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol |  
		| 6852409 | 2,3-dihydroxybutanedioic acid; 4-[(1S)-1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol |  
 | internal high similarity DBLink  | Rows returned: 3 |  | 
 
 | active | Cluster 1040 | Additional Members: 10 | Rows returned: 0 |  | 
 
 |