Compound Information | SONAR Target prediction | Name: | R(-)-Isoproterenol (+)-bitartrate | Unique Identifier: | LOPAC 00113 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H23NO9 | Molecular Weight: | 339.17 g/mol | X log p: | 6.006 (online calculus) | Lipinksi Failures | 1 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(C)NCC(O)c1ccc(O)c(O)c1.OC(C(O)C(O)=O)C(O)=O | Class: | Adrenoceptor | Action: | Agonist | Selectivity: | beta |
Species: |
4932 |
Condition: |
NOP16 |
Replicates: |
2 |
Raw OD Value: r im |
0.6823±0.00339411 |
Normalized OD Score: sc h |
0.9835±0.0070213 |
Z-Score: |
-0.7496±0.237662 |
p-Value: |
0.459826 |
Z-Factor: |
-22.4226 |
Fitness Defect: |
0.7769 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 8|H11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-04-22 YYYY-MM-DD | Plate CH Control (+): | 0.044925±0.00230 | Plate DMSO Control (-): | 0.706275±0.04392 | Plate Z-Factor: | 0.8266 |
| png ps pdf |
DBLink | Rows returned: 5 | |
26792 |
2,3-dihydroxybutanedioic acid; 4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol |
160420 |
(2R,3R)-2,3-dihydroxybutanedioic acid; 4-[1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol |
2724018 |
(2R,3R)-2,3-dihydroxybutanedioic acid; 4-[(1S)-1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol |
6604115 |
(2R,3S)-2,3-dihydroxybutanedioic acid; 4-[(1R)-1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol |
6852409 |
2,3-dihydroxybutanedioic acid; 4-[(1S)-1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 1040 | Additional Members: 10 | Rows returned: 0 | |
|