Compound Information | SONAR Target prediction | Name: | 3,7-Dimethyl-I-propargylxanthine | Unique Identifier: | LOPAC 00090 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10H10N4O2 | Molecular Weight: | 208.133 g/mol | X log p: | 2.003 (online calculus) | Lipinksi Failures | 0 | TPSA | 56.22 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 6 | Rotatable Bond Count: | 1 | Canonical Smiles: | Cn1cnc2N(C)C(=O)N(CC#C)C(=O)c12 | Class: | Adenosine | Action: | Antagonist | Selectivity: | A2 |
Species: |
4932 |
Condition: |
ESC2 |
Replicates: |
2 |
Raw OD Value: r im |
0.4539±0.0172534 |
Normalized OD Score: sc h |
0.9892±0.00909533 |
Z-Score: |
-0.3264±0.261235 |
p-Value: |
0.748336 |
Z-Factor: |
-9.54073 |
Fitness Defect: |
0.2899 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 6|C9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 28.20 Celcius | Date: | 2005-11-25 YYYY-MM-DD | Plate CH Control (+): | 0.039975±0.00183 | Plate DMSO Control (-): | 0.5199750000000001±0.04036 | Plate Z-Factor: | 0.8117 |
| png ps pdf |
DBLink | Rows returned: 1 | |
99562 |
3,7-dimethyl-1-prop-2-ynyl-purine-2,6-dione |
internal high similarity DBLink | Rows returned: 0 | |
nonactive | Cluster 834 | Additional Members: 4 | Rows returned: 2 | |
|