| Compound Information | SONAR Target prediction |
| Name: | Podophyllotoxin |
| Unique Identifier: | LOPAC 00066 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C22H22O8 |
| Molecular Weight: | 392.231 g/mol |
| X log p: | 10.107 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 72.45 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 8 |
| Rotatable Bond Count: | 4 |
| Canonical Smiles: | COc1cc(cc(OC)c1OC)C1C2C(COC2=O)C(O)c2cc3OCOc3cc12 |
| Class: | Cytoskeleton and ECM |
| Action: | Inhibitor |
| Generic_name: | Podofilox |
| Chemical_iupac_name: | 5,8,8a,9-Tetrahydro-9-hydroxy-5- (3,4,5-trimethoxylphenyl)furo [3-,4-:6,7] naphtho
[2,3,d] -1,3-dioxol- 6(5aH)-one |
| Drug_type: | Approved Drug |
| Pharmgkb_id: | PA450993 |
| Kegg_compound_id: | C10871 |
| Drugbank_id: | APRD01189 |
| Melting_point: | 228 oC |
| H2o_solubility: | 100 mg/L |
| Logp: | 2.317 |
| Cas_registry_number: | 477-47-4 |
| Drug_category: | Antimitotic agent; Antineoplastic Agents, Phytogenic; Keratolytic Agents |
| Indication: | For treatment of external genital warts (Condyloma acuminatum). |
| Pharmacology: | Podofilox, also called podophyllotoxin, is a purer and more stable form of
podophyllin in which only the biologically active portion of the compound is
present. Podofilox is used to remove certain types of warts on the outside skin of
the genital areas. |
| Mechanism_of_action: | The exact mechanism of action is unknown. |
| Organisms_affected: | Condyloma acuminatum |
