| Compound Information | SONAR Target prediction |  | Name: | 2-Phenylaminoadenosine |  | Unique Identifier: | LOPAC 00061  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C16H18N6O4 |  | Molecular Weight: | 340.209 g/mol |  | X log p: | 10.673  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 49.55 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 10 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | Nc1nc(Nc2ccccc2)nc2n(cnc12)C1OC(CO)C(O)C1O |  | Class: | Adenosine |  | Action: | Agonist |  | Selectivity: | A2 > A1 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		CLN3 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7235±0.0178898 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0495±0.00957613 | 
	 
	
		| Z-Score: | 
		1.6942±0.0518024 | 
	 
	
		| p-Value: | 
		0.0904494 | 
	 
	
		| Z-Factor: | 
		-1.72295 | 
	 
	
		| Fitness Defect: | 
		2.403 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Lopac |  | Plate Number and Position: | 13|B7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 27.90 Celcius |  | Date: | 2005-05-08 YYYY-MM-DD |  | Plate CH Control (+): | 0.048100000000000004±0.00077 |  | Plate DMSO Control (-): | 0.681825±0.03666 |  | Plate Z-Factor: | 0.8231 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 5 |  |  
 
	
		| 1585 | 
		2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol | 
	 
	
		| 122170 | 
		(3R,4R,5R)-2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol | 
	 
	
		| 6603953 | 
		(2R,3S,4S,5S)-2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol | 
	 
	
		| 6604904 | 
		(2R,3R,4S,5S)-2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol | 
	 
	
		| 6917803 | 
		(2R,3R,4R,5R)-2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 9750 | Additional Members: 25 | Rows returned: 4 |  |   
 
 |