| Compound Information | SONAR Target prediction | | Name: | 2-Phenylaminoadenosine | | Unique Identifier: | LOPAC 00061 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C16H18N6O4 | | Molecular Weight: | 340.209 g/mol | | X log p: | 10.673 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 49.55 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 10 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | Nc1nc(Nc2ccccc2)nc2n(cnc12)C1OC(CO)C(O)C1O | | Class: | Adenosine | | Action: | Agonist | | Selectivity: | A2 > A1 |
| Species: |
4932 |
| Condition: |
SQS1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7294±0.011738 |
| Normalized OD Score: sc h |
1.0070±0.00335966 |
| Z-Score: |
0.3689±0.247397 |
| p-Value: |
0.71639 |
| Z-Factor: |
-8.66136 |
| Fitness Defect: |
0.3335 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 13|B7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 0.00 Celcius | | Date: | 2005-05-21 YYYY-MM-DD | | Plate CH Control (+): | 0.049025±0.00179 | | Plate DMSO Control (-): | 0.721975±0.02769 | | Plate Z-Factor: | 0.8852 |
| png ps pdf |
| DBLink | Rows returned: 5 | |
| 1585 |
2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| 122170 |
(3R,4R,5R)-2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| 6603953 |
(2R,3S,4S,5S)-2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| 6604904 |
(2R,3R,4S,5S)-2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| 6917803 |
(2R,3R,4R,5R)-2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| internal high similarity DBLink | Rows returned: 0 | |
|