Compound Information | SONAR Target prediction | Name: | 2-Phenylaminoadenosine | Unique Identifier: | LOPAC 00061 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C16H18N6O4 | Molecular Weight: | 340.209 g/mol | X log p: | 10.673 (online calculus) | Lipinksi Failures | 1 | TPSA | 49.55 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 10 | Rotatable Bond Count: | 4 | Canonical Smiles: | Nc1nc(Nc2ccccc2)nc2n(cnc12)C1OC(CO)C(O)C1O | Class: | Adenosine | Action: | Agonist | Selectivity: | A2 > A1 |
Species: |
4932 |
Condition: |
LGE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.4708±0.0167584 |
Normalized OD Score: sc h |
1.0059±0.00200935 |
Z-Score: |
0.2008±0.063066 |
p-Value: |
0.84099 |
Z-Factor: |
-15.5155 |
Fitness Defect: |
0.1732 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 13|B7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.80 Celcius | Date: | 2005-11-29 YYYY-MM-DD | Plate CH Control (+): | 0.0387±0.00047 | Plate DMSO Control (-): | 0.441825±0.01844 | Plate Z-Factor: | 0.8271 |
| png ps pdf |
DBLink | Rows returned: 5 | |
1585 |
2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
122170 |
(3R,4R,5R)-2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
6603953 |
(2R,3S,4S,5S)-2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
6604904 |
(2R,3R,4S,5S)-2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
6917803 |
(2R,3R,4R,5R)-2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
internal high similarity DBLink | Rows returned: 0 | |
|