| Compound Information | SONAR Target prediction | | Name: | 2-Phenylaminoadenosine | | Unique Identifier: | LOPAC 00061 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C16H18N6O4 | | Molecular Weight: | 340.209 g/mol | | X log p: | 10.673 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 49.55 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 10 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | Nc1nc(Nc2ccccc2)nc2n(cnc12)C1OC(CO)C(O)C1O | | Class: | Adenosine | | Action: | Agonist | | Selectivity: | A2 > A1 |
| Species: |
4932 |
| Condition: |
BY4741 |
| Replicates: |
8 |
| Raw OD Value: r im |
0.7607±0.0544191 |
| Normalized OD Score: sc h |
0.9992±0.0145085 |
| Z-Score: |
-0.0274±0.546249 |
| p-Value: |
0.775696 |
| Z-Factor: |
-9.9398 |
| Fitness Defect: |
0.254 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 13|B7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.80 Celcius | | Date: | 2005-04-07 YYYY-MM-DD | | Plate CH Control (+): | 0.04800625000000002±0.00227 | | Plate DMSO Control (-): | 0.7375000000000003±0.02694 | | Plate Z-Factor: | 0.9214 |
|  png
ps
pdf |
| DBLink | Rows returned: 5 | |
| 1585 |
2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| 122170 |
(3R,4R,5R)-2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| 6603953 |
(2R,3S,4S,5S)-2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| 6604904 |
(2R,3R,4S,5S)-2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| 6917803 |
(2R,3R,4R,5R)-2-(6-amino-2-anilino-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 9750 | Additional Members: 25 | Rows returned: 4 | |
|
