| Compound Information | SONAR Target prediction |  | Name: | alpha,beta-Methylene adenosine 5`-triphosphate dilithium |  | Unique Identifier: | LOPAC 00052  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C11H16Li2N5O12P3 |  | Molecular Weight: | 500.947 g/mol |  | X log p: | -1.477  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 194.77 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 17 |  | Rotatable Bond Count: | 8 |  | Canonical Smiles: | [Li+].[Li+].[O-]P([O-])(=O)OP(O)(=O)CP(O)(=O)OCC1OC(C(O)C1O)n1cnc2c(N) ncnc12 |  | Class: | P2 Receptor |  | Action: | Agonist |  | Selectivity: | P2X > P2Y |  | Generic_name: | ALPHA,BETA-METHYLENEADENOSINE-5--TRIPHOS |  | Chemical_iupac_name: | DIPHOSPHOMETHYLPHOSPHONIC ACID ADENOSYL ESTER |  | Drug_type: | Experimental |  | Drugbank_id: | EXPT00539 |  | Drug_category: | 6-Hydroxymethyl-7,8-Dihydropterin Pyrophosph inhibitor |  | Organisms_affected: | -1 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		GIM3 | 
	 
	
		| Replicates: | 
		4 | 
	 
	
		| Raw OD Value: r im | 
		0.4969±0.0639947 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0034±0.014681 | 
	 
	
		| Z-Score: | 
		0.0816±0.292049 | 
	 
	
		| p-Value: | 
		0.837562 | 
	 
	
		| Z-Factor: | 
		-4.39177 | 
	 
	
		| Fitness Defect: | 
		0.1773 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Lopac |  | Plate Number and Position: | 10|D10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 27.70 Celcius |  | Date: | 2005-04-08 YYYY-MM-DD |  | Plate CH Control (+): | 0.0449625±0.00068 |  | Plate DMSO Control (-): | 0.6567000000000002±0.13731 |  | Plate Z-Factor: | -0.1642 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 4 |  |  
 
	
		| 3104 | 
		[[[5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl]methyl-hydroxy-phosphoryl] oxyphosphonic acid | 
	 
	
		| 91557 | 
		[[[(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl]methyl-hydro xy-phosphoryl]oxyphosphonic acid | 
	 
	
		| 6604133 | 
		dilithium [[(2S,3S,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl]methyl-phosph onatooxy-phosphinic acid | 
	 
	
		| 6604134 | 
		[[[(2S,3S,4S,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxy-oxolan-2-yl]methoxy-hydroxy-phosphoryl]methyl-hydro xy-phosphoryl]oxyphosphonic acid | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
  
 
 |