| Compound Information | SONAR Target prediction |  | Name: | N6-Methyladenosine |  | Unique Identifier: | LOPAC 00050  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C11H15N5O4 |  | Molecular Weight: | 266.149 g/mol |  | X log p: | 3.289  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 49.55 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 9 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | CNc1ncnc2n(cnc12)C1OC(CO)C(O)C1O |  | Class: | Adenosine |  | Action: | Agonist |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		ESC2 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.4628±0.0238295 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9962±0.0367367 | 
	 
	
		| Z-Score: | 
		-0.1556±1.14995 | 
	 
	
		| p-Value: | 
		0.42175 | 
	 
	
		| Z-Factor: | 
		-17.0912 | 
	 
	
		| Fitness Defect: | 
		0.8633 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Lopac |  | Plate Number and Position: | 10|D9 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 28.30 Celcius |  | Date: | 2005-11-25 YYYY-MM-DD |  | Plate CH Control (+): | 0.039150000000000004±0.00155 |  | Plate DMSO Control (-): | 0.4617±0.01624 |  | Plate Z-Factor: | 0.8683 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 4 |  |  
 
	
		| 1869 | 
		2-(hydroxymethyl)-5-(6-methylaminopurin-9-yl)oxolane-3,4-diol | 
	 
	
		| 101382 | 
		(2R,3R,4S,5R)-2-(hydroxymethyl)-5-(6-methylaminopurin-9-yl)oxolane-3,4-diol | 
	 
	
		| 102175 | 
		(2R,3R,4R,5R)-2-(hydroxymethyl)-5-(6-methylaminopurin-9-yl)oxolane-3,4-diol | 
	 
	
		| 5284425 | 
		(2S,3S,4S,5R)-2-(hydroxymethyl)-5-(6-methylaminopurin-9-yl)oxolane-3,4-diol | 
	 
 
 | internal high similarity DBLink  | Rows returned: 4 |  |   
 |  active | Cluster 16028 | Additional Members: 4 | Rows returned: 0 |  |  
  
 |