| Compound Information | SONAR Target prediction | | Name: | N6-Methyladenosine | | Unique Identifier: | LOPAC 00050 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C11H15N5O4 | | Molecular Weight: | 266.149 g/mol | | X log p: | 3.289 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 49.55 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 9 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | CNc1ncnc2n(cnc12)C1OC(CO)C(O)C1O | | Class: | Adenosine | | Action: | Agonist |
| Species: |
4932 |
| Condition: |
KRE1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6276±0.00883884 |
| Normalized OD Score: sc h |
0.9981±0.00726336 |
| Z-Score: |
-0.0742±0.307438 |
| p-Value: |
0.82837 |
| Z-Factor: |
-96.2914 |
| Fitness Defect: |
0.1883 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 10|D9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.90 Celcius | | Date: | 2005-11-22 YYYY-MM-DD | | Plate CH Control (+): | 0.0388±0.00411 | | Plate DMSO Control (-): | 0.616575±0.01314 | | Plate Z-Factor: | 0.9242 |
|  png
ps
pdf |
| DBLink | Rows returned: 4 | |
| 1869 |
2-(hydroxymethyl)-5-(6-methylaminopurin-9-yl)oxolane-3,4-diol |
| 101382 |
(2R,3R,4S,5R)-2-(hydroxymethyl)-5-(6-methylaminopurin-9-yl)oxolane-3,4-diol |
| 102175 |
(2R,3R,4R,5R)-2-(hydroxymethyl)-5-(6-methylaminopurin-9-yl)oxolane-3,4-diol |
| 5284425 |
(2S,3S,4S,5R)-2-(hydroxymethyl)-5-(6-methylaminopurin-9-yl)oxolane-3,4-diol |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 16028 | Additional Members: 4 | Rows returned: 0 | |
|
