Compound Information | SONAR Target prediction | Name: | 2-Chloroadenosine | Unique Identifier: | LOPAC 00014 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10ClH12N5O4 | Molecular Weight: | 289.591 g/mol | X log p: | 1.286 (online calculus) | Lipinksi Failures | 0 | TPSA | 49.55 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 9 | Rotatable Bond Count: | 2 | Canonical Smiles: | Nc1nc(Cl)nc2n(cnc12)C1OC(CO)C(O)C1O | Class: | Adenosine | Action: | Agonist | Selectivity: | A1 > A2 |
Species: |
4932 |
Condition: |
BY4741 |
Replicates: |
8 |
Raw OD Value: r im |
0.7869±0.0831137 |
Normalized OD Score: sc h |
0.9853±0.0278018 |
Z-Score: |
-0.4155±0.935354 |
p-Value: |
0.40766 |
Z-Factor: |
-91.5808 |
Fitness Defect: |
0.8973 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 4|F5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.60 Celcius | Date: | 2005-04-07 YYYY-MM-DD | Plate CH Control (+): | 0.04620624999999999±0.00241 | Plate DMSO Control (-): | 0.7474874999999999±0.05282 | Plate Z-Factor: | 0.8689 |
| png ps pdf |
DBLink | Rows returned: 4 | |
8974 |
(2R,3R,4R,5R)-2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
235481 |
2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
474900 |
(2S,3S,4R,5S)-2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
6603778 |
(2R,3R,4R,5S)-2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
internal high similarity DBLink | Rows returned: 3 | |
|