Compound Information | SONAR Target prediction | Name: | 2-Chloroadenosine | Unique Identifier: | LOPAC 00014 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C10ClH12N5O4 | Molecular Weight: | 289.591 g/mol | X log p: | 1.286 (online calculus) | Lipinksi Failures | 0 | TPSA | 49.55 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 9 | Rotatable Bond Count: | 2 | Canonical Smiles: | Nc1nc(Cl)nc2n(cnc12)C1OC(CO)C(O)C1O | Class: | Adenosine | Action: | Agonist | Selectivity: | A1 > A2 |
Species: |
4932 |
Condition: |
tep1-2nd |
Replicates: |
2 |
Raw OD Value: r im |
0.7616±0.0297692 |
Normalized OD Score: sc h |
1.0005±0.0305694 |
Z-Score: |
0.0103±1.15969 |
p-Value: |
0.412226 |
Z-Factor: |
-23.7112 |
Fitness Defect: |
0.8862 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Lopac | Plate Number and Position: | 4|F5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 0.00 Celcius | Date: | 2005-07-07 YYYY-MM-DD | Plate CH Control (+): | 0.04290000000000001±0.00205 | Plate DMSO Control (-): | 0.6973500000000001±0.04028 | Plate Z-Factor: | 0.7457 |
| png ps pdf |
DBLink | Rows returned: 4 | |
8974 |
(2R,3R,4R,5R)-2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
235481 |
2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
474900 |
(2S,3S,4R,5S)-2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
6603778 |
(2R,3R,4R,5S)-2-(6-amino-2-chloro-purin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 9750 | Additional Members: 25 | Rows returned: 4 | |
|