| Compound Information | SONAR Target prediction | | Name: | 1,7-Dimethylxanthine | | Unique Identifier: | LOPAC 00004 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C7H8N4O2 | | Molecular Weight: | 172.101 g/mol | | X log p: | 1.673 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 52.98 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | Cn1cnc2NC(=O)N(C)C(=O)c12 | | Class: | Adenosine | | Action: | Antagonist | | Selectivity: | A1 > A2 |
| Species: |
4932 |
| Condition: |
GAS1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7008±0.00360624 |
| Normalized OD Score: sc h |
0.9813±0.0139583 |
| Z-Score: |
-0.8947±0.669992 |
| p-Value: |
0.42247 |
| Z-Factor: |
-5.06328 |
| Fitness Defect: |
0.8616 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 5|G10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.40 Celcius | | Date: | 2005-11-17 YYYY-MM-DD | | Plate CH Control (+): | 0.040400000000000005±0.00500 | | Plate DMSO Control (-): | 0.72265±0.01753 | | Plate Z-Factor: | 0.9046 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 4687 |
1,7-dimethyl-3H-purine-2,6-dione |
| internal high similarity DBLink | Rows returned: 5 | |
| active | Cluster 11665 | Additional Members: 2 | Rows returned: 0 | |
|