| Compound Information | SONAR Target prediction |  | Name: | 1,7-Dimethylxanthine |  | Unique Identifier: | LOPAC 00004  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C7H8N4O2 |  | Molecular Weight: | 172.101 g/mol |  | X log p: | 1.673  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 52.98 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | Cn1cnc2NC(=O)N(C)C(=O)c12 |  | Class: | Adenosine |  | Action: | Antagonist |  | Selectivity: | A1 > A2 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		SQS1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7151±0.00219203 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9896±0.0253693 | 
	 
	
		| Z-Score: | 
		-0.3795±1.15353 | 
	 
	
		| p-Value: | 
		0.447364 | 
	 
	
		| Z-Factor: | 
		-146.016 | 
	 
	
		| Fitness Defect: | 
		0.8044 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Lopac |  | Plate Number and Position: | 5|G10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 0.00 Celcius |  | Date: | 2005-05-21 YYYY-MM-DD |  | Plate CH Control (+): | 0.048799999999999996±0.00120 |  | Plate DMSO Control (-): | 0.74105±0.02560 |  | Plate Z-Factor: | 0.8869 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 4687 | 
		1,7-dimethyl-3H-purine-2,6-dione | 
	 
 
 | internal high similarity DBLink  | Rows returned: 5 |  |   
 |  active | Cluster 11665 | Additional Members: 2 | Rows returned: 0 |  |  
  
 |