| Compound Information | SONAR Target prediction |  | Name: | 1,7-Dimethylxanthine |  | Unique Identifier: | LOPAC 00004  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C7H8N4O2 |  | Molecular Weight: | 172.101 g/mol |  | X log p: | 1.673  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 52.98 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 6 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | Cn1cnc2NC(=O)N(C)C(=O)c12 |  | Class: | Adenosine |  | Action: | Antagonist |  | Selectivity: | A1 > A2 |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		MRC1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.8561±0.0231931 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0066±0.0169823 | 
	 
	
		| Z-Score: | 
		0.4245±1.19489 | 
	 
	
		| p-Value: | 
		0.439236 | 
	 
	
		| Z-Factor: | 
		-48.1599 | 
	 
	
		| Fitness Defect: | 
		0.8227 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Lopac |  | Plate Number and Position: | 5|G10 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 24.90 Celcius |  | Date: | 2005-12-06 YYYY-MM-DD |  | Plate CH Control (+): | 0.3314±0.21684 |  | Plate DMSO Control (-): | 0.813625±0.01988 |  | Plate Z-Factor: | 0.4359 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 1 |  |  
 
	
		| 4687 | 
		1,7-dimethyl-3H-purine-2,6-dione | 
	 
 
 | internal high similarity DBLink  | Rows returned: 5 |  |   
 |  nonactive | Cluster 11665 | Additional Members: 2 | Rows returned: 1 |  |   
 
 |