| Compound Information | SONAR Target prediction | | Name: | 1,7-Dimethylxanthine | | Unique Identifier: | LOPAC 00004 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C7H8N4O2 | | Molecular Weight: | 172.101 g/mol | | X log p: | 1.673 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 52.98 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | Cn1cnc2NC(=O)N(C)C(=O)c12 | | Class: | Adenosine | | Action: | Antagonist | | Selectivity: | A1 > A2 |
| Species: |
4932 |
| Condition: |
BY4741 |
| Replicates: |
8 |
| Raw OD Value: r im |
0.7701±0.0770315 |
| Normalized OD Score: sc h |
0.9863±0.0275667 |
| Z-Score: |
-0.5135±1.06858 |
| p-Value: |
0.608022 |
| Z-Factor: |
-16.6416 |
| Fitness Defect: |
0.4975 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Lopac | | Plate Number and Position: | 5|G10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.60 Celcius | | Date: | 2005-04-07 YYYY-MM-DD | | Plate CH Control (+): | 0.04706875±0.00209 | | Plate DMSO Control (-): | 0.7644374999999999±0.04321 | | Plate Z-Factor: | 0.8209 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 4687 |
1,7-dimethyl-3H-purine-2,6-dione |
| internal high similarity DBLink | Rows returned: 5 | |
| active | Cluster 11665 | Additional Members: 2 | Rows returned: 0 | |
|