| Compound Information | SONAR Target prediction | | Name: | Novel | | Unique Identifier: | LAT017H02 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H18O4 | | Molecular Weight: | 268.18 g/mol | | X log p: | 15.142 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CC(C)Oc1ccc(CC(=O)c2ccc(O)cc2O)cc1 |
| Species: |
4932 |
| Condition: |
wt18h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6254±0.0668216 |
| Normalized OD Score: sc h |
0.7786±0.118937 |
| Z-Score: |
-5.9499±2.27767 |
| p-Value: |
0.00000714434 |
| Z-Factor: |
-0.921003 |
| Fitness Defect: |
11.8492 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 17|H2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.90 Celcius | | Date: | 2007-02-28 YYYY-MM-DD | | Plate CH Control (+): | 0.039749999999999994±0.00332 | | Plate DMSO Control (-): | 0.7671250000000001±0.01409 | | Plate Z-Factor: | 0.9341 |
| png ps pdf |
| DBLink | Rows returned: 1 | |
| 765925 |
1-(2,4-dihydroxyphenyl)-2-(4-propan-2-yloxyphenyl)ethanone |
| internal high similarity DBLink | Rows returned: 0 | |
|