Compound Information | SONAR Target prediction | Name: | Novel | Unique Identifier: | LAT017H02 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C17H18O4 | Molecular Weight: | 268.18 g/mol | X log p: | 15.142 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 5 | Canonical Smiles: | CC(C)Oc1ccc(CC(=O)c2ccc(O)cc2O)cc1 |
Species: |
4932 |
Condition: |
pdr22h |
Replicates: |
2 |
Raw OD Value: r im |
0.4341±0.00247487 |
Normalized OD Score: sc h |
0.6521±0.00362549 |
Z-Score: |
-13.6488±1.83095 |
p-Value: |
2.3127e-35 |
Z-Factor: |
0.826411 |
Fitness Defect: |
79.7521 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 17|H2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.10 Celcius | Date: | 2007-03-08 YYYY-MM-DD | Plate CH Control (+): | 0.04045±0.00155 | Plate DMSO Control (-): | 0.6599999999999999±0.01098 | Plate Z-Factor: | 0.9376 |
| png ps pdf |
DBLink | Rows returned: 1 | |
765925 |
1-(2,4-dihydroxyphenyl)-2-(4-propan-2-yloxyphenyl)ethanone |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 16963 | Additional Members: 14 | Rows returned: 5 | |
|