| Compound Information | SONAR Target prediction | | Name: | Novel | | Unique Identifier: | LAT017H02 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C17H18O4 | | Molecular Weight: | 268.18 g/mol | | X log p: | 15.142 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CC(C)Oc1ccc(CC(=O)c2ccc(O)cc2O)cc1 |
| Species: |
4932 |
| Condition: |
pdr18h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.2253±0.00155563 |
| Normalized OD Score: sc h |
0.3662±0.0117751 |
| Z-Score: |
-17.7942±1.67833 |
| p-Value: |
0 |
| Z-Factor: |
0.852497 |
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 17|H2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.20 Celcius | | Date: | 2007-03-08 YYYY-MM-DD | | Plate CH Control (+): | 0.039775000000000005±0.00212 | | Plate DMSO Control (-): | 0.632725±0.01230 | | Plate Z-Factor: | 0.9400 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 765925 |
1-(2,4-dihydroxyphenyl)-2-(4-propan-2-yloxyphenyl)ethanone |
| internal high similarity DBLink | Rows returned: 0 | |
|
