Compound Information | SONAR Target prediction | Name: | Novel | Unique Identifier: | LAT017G05 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C14FH11O3 | Molecular Weight: | 235.146 g/mol | X log p: | 15.016 (online calculus) | Lipinksi Failures | 1 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 3 | Canonical Smiles: | Oc1ccc(c(O)c1)C(=O)Cc1ccccc1F |
Species: |
4932 |
Condition: |
wt18h |
Replicates: |
2 |
Raw OD Value: r im |
0.7086±0.0618011 |
Normalized OD Score: sc h |
0.8968±0.0975462 |
Z-Score: |
-2.6371±2.25011 |
p-Value: |
0.147791 |
Z-Factor: |
-2.61452 |
Fitness Defect: |
1.912 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 17|G5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.90 Celcius | Date: | 2007-02-28 YYYY-MM-DD | Plate CH Control (+): | 0.039749999999999994±0.00332 | Plate DMSO Control (-): | 0.7671250000000001±0.01409 | Plate Z-Factor: | 0.9341 |
| png ps pdf |
DBLink | Rows returned: 2 | |
798879 |
1-(2,4-dihydroxyphenyl)-2-(2-fluorophenyl)ethanone |
9179199 |
2-(2-fluorophenyl)-1-(2,4,6-trihydroxyphenyl)ethanone |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 16963 | Additional Members: 14 | Rows returned: 6 | |
|