| Compound Information | SONAR Target prediction |  | Name: | Novel |  | Unique Identifier: | LAT017G05  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: | C14FH11O3 |  | Molecular Weight: | 235.146 g/mol |  | X log p: | 15.016  (online calculus) |  | Lipinksi Failures | 1 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 3 |  | Rotatable Bond Count: | 3 |  | Canonical Smiles: | Oc1ccc(c(O)c1)C(=O)Cc1ccccc1F |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		pdr24h | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.7284±0.00106066 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0419±0.00364698 | 
	 
	
		| Z-Score: | 
		1.8984±0.131805 | 
	 
	
		| p-Value: | 
		0.0587296 | 
	 
	
		| Z-Factor: | 
		-0.606983 | 
	 
	
		| Fitness Defect: | 
		2.8348 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | LATCA |  | Plate Number and Position: | 17|G5 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 27.20 Celcius |  | Date: | 2007-03-08 YYYY-MM-DD |  | Plate CH Control (+): | 0.0402±0.00165 |  | Plate DMSO Control (-): | 0.6852250000000001±0.01178 |  | Plate Z-Factor: | 0.9505 |  
  |  png ps pdf |  
 
 | DBLink  | Rows returned: 2 |  |  
 
	
		| 798879 | 
		1-(2,4-dihydroxyphenyl)-2-(2-fluorophenyl)ethanone | 
	 
	
		| 9179199 | 
		2-(2-fluorophenyl)-1-(2,4,6-trihydroxyphenyl)ethanone | 
	 
 
 | internal high similarity DBLink  | Rows returned: 0 |  |  
 
 |  active | Cluster 16963 | Additional Members: 14 | Rows returned: 6 |  |   
 
 |