| Compound Information | SONAR Target prediction | | Name: | Novel | | Unique Identifier: | LAT017G05 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C14FH11O3 | | Molecular Weight: | 235.146 g/mol | | X log p: | 15.016 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | Oc1ccc(c(O)c1)C(=O)Cc1ccccc1F |
| Species: |
4932 |
| Condition: |
pdr18h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6009±0.0143543 |
| Normalized OD Score: sc h |
0.9772±0.0614826 |
| Z-Score: |
-0.5687±1.78064 |
| p-Value: |
0.278766 |
| Z-Factor: |
-10.188 |
| Fitness Defect: |
1.2774 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 17|G5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.20 Celcius | | Date: | 2007-03-08 YYYY-MM-DD | | Plate CH Control (+): | 0.039775000000000005±0.00212 | | Plate DMSO Control (-): | 0.632725±0.01230 | | Plate Z-Factor: | 0.9400 |
|  png
ps
pdf |
| DBLink | Rows returned: 2 | |
| 798879 |
1-(2,4-dihydroxyphenyl)-2-(2-fluorophenyl)ethanone |
| 9179199 |
2-(2-fluorophenyl)-1-(2,4,6-trihydroxyphenyl)ethanone |
| internal high similarity DBLink | Rows returned: 0 | |
|
