| Compound Information | SONAR Target prediction | | Name: | Novel | | Unique Identifier: | LAT017F11 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C16H16O4 | | Molecular Weight: | 256.169 g/mol | | X log p: | 15.172 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | CCOc1ccc(CC(=O)c2ccc(O)cc2O)cc1 |
| Species: |
4932 |
| Condition: |
wt24h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7473±0.0039598 |
| Normalized OD Score: sc h |
0.9707±0.000595618 |
| Z-Score: |
-1.1330±0.448513 |
| p-Value: |
0.280784 |
| Z-Factor: |
-1.5526 |
| Fitness Defect: |
1.2702 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 17|F11 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 1 nm | | Robot Temperature: | 25.10 Celcius | | Date: | 2007-02-28 YYYY-MM-DD | | Plate CH Control (+): | 0.04085±0.00245 | | Plate DMSO Control (-): | 0.7619499999999999±0.01479 | | Plate Z-Factor: | 0.9506 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 895501 |
1-(2,4-dihydroxyphenyl)-2-(4-ethoxyphenyl)ethanone |
| internal high similarity DBLink | Rows returned: 0 | |
|
