Compound Information | SONAR Target prediction | Name: | Novel | Unique Identifier: | LAT017F11 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C16H16O4 | Molecular Weight: | 256.169 g/mol | X log p: | 15.172 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 5 | Canonical Smiles: | CCOc1ccc(CC(=O)c2ccc(O)cc2O)cc1 |
Species: |
4932 |
Condition: |
wt24h |
Replicates: |
2 |
Raw OD Value: r im |
0.7473±0.0039598 |
Normalized OD Score: sc h |
0.9707±0.000595618 |
Z-Score: |
-1.1330±0.448513 |
p-Value: |
0.280784 |
Z-Factor: |
-1.5526 |
Fitness Defect: |
1.2702 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 17|F11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 1 nm | Robot Temperature: | 25.10 Celcius | Date: | 2007-02-28 YYYY-MM-DD | Plate CH Control (+): | 0.04085±0.00245 | Plate DMSO Control (-): | 0.7619499999999999±0.01479 | Plate Z-Factor: | 0.9506 |
| png ps pdf |
DBLink | Rows returned: 1 | |
895501 |
1-(2,4-dihydroxyphenyl)-2-(4-ethoxyphenyl)ethanone |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 16963 | Additional Members: 14 | Rows returned: 6 | |
|