Compound Information | SONAR Target prediction | Name: | Novel | Unique Identifier: | LAT017F05 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C16Cl2H12O2 | Molecular Weight: | 295.075 g/mol | X log p: | 13.907 (online calculus) | Lipinksi Failures | 1 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 1 | Canonical Smiles: | Oc1ccc2C(CCC(=O)c2c1)c1ccc(Cl)c(Cl)c1 |
Species: |
4932 |
Condition: |
wt18h |
Replicates: |
2 |
Raw OD Value: r im |
0.0839±0.0152735 |
Normalized OD Score: sc h |
0.1056±0.0222659 |
Z-Score: |
-25.3454±3.78387 |
p-Value: |
0 |
Z-Factor: |
0.86263 |
Fitness Defect: |
INF |
Bioactivity Statement: |
Toxic |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 17|F5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.90 Celcius | Date: | 2007-02-28 YYYY-MM-DD | Plate CH Control (+): | 0.039749999999999994±0.00332 | Plate DMSO Control (-): | 0.7671250000000001±0.01409 | Plate Z-Factor: | 0.9341 |
| png ps pdf |
DBLink | Rows returned: 3 | |
1121949 |
(4S)-4-(3,4-dichlorophenyl)-7-hydroxy-tetralin-1-one |
1121951 |
(4R)-4-(3,4-dichlorophenyl)-7-hydroxy-tetralin-1-one |
2913934 |
4-(3,4-dichlorophenyl)-7-hydroxy-tetralin-1-one |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 1690 | Additional Members: 4 | Rows returned: 3 | |
|