| Compound Information | SONAR Target prediction | | Name: | Novel | | Unique Identifier: | LAT017F05 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C16Cl2H12O2 | | Molecular Weight: | 295.075 g/mol | | X log p: | 13.907 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | Oc1ccc2C(CCC(=O)c2c1)c1ccc(Cl)c(Cl)c1 |
| Species: |
4932 |
| Condition: |
pdr22h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.0407±0.000777817 |
| Normalized OD Score: sc h |
0.0611±0.000480886 |
| Z-Score: |
-36.9794±4.30756 |
| p-Value: |
0 |
| Z-Factor: |
0.945446 |
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Toxic |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 17|F5 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.10 Celcius | | Date: | 2007-03-08 YYYY-MM-DD | | Plate CH Control (+): | 0.04045±0.00155 | | Plate DMSO Control (-): | 0.6599999999999999±0.01098 | | Plate Z-Factor: | 0.9376 |
| png ps pdf |
| DBLink | Rows returned: 3 | |
| 1121949 |
(4S)-4-(3,4-dichlorophenyl)-7-hydroxy-tetralin-1-one |
| 1121951 |
(4R)-4-(3,4-dichlorophenyl)-7-hydroxy-tetralin-1-one |
| 2913934 |
4-(3,4-dichlorophenyl)-7-hydroxy-tetralin-1-one |
| internal high similarity DBLink | Rows returned: 0 | |
| nonactive | Cluster 1690 | Additional Members: 4 | Rows returned: 2 | |
|