Compound Information | SONAR Target prediction | Name: | Novel | Unique Identifier: | LAT017D05 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C15H14O3 | Molecular Weight: | 228.159 g/mol | X log p: | 15.025 (online calculus) | Lipinksi Failures | 1 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 3 | Canonical Smiles: | Cc1ccccc1CC(=O)c1ccc(O)cc1O |
Species: |
4932 |
Condition: |
pdr24h |
Replicates: |
2 |
Raw OD Value: r im |
0.7372±0.000989949 |
Normalized OD Score: sc h |
1.0546±0.00381088 |
Z-Score: |
2.4424±0.126204 |
p-Value: |
0.0149851 |
Z-Factor: |
-0.221893 |
Fitness Defect: |
4.2007 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 17|D5 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.20 Celcius | Date: | 2007-03-08 YYYY-MM-DD | Plate CH Control (+): | 0.0402±0.00165 | Plate DMSO Control (-): | 0.6852250000000001±0.01178 | Plate Z-Factor: | 0.9505 |
| png ps pdf |
DBLink | Rows returned: 1 | |
805676 |
1-(2,4-dihydroxyphenyl)-2-(2-methylphenyl)ethanone |
internal high similarity DBLink | Rows returned: 0 | |
|