Compound Information | SONAR Target prediction | Name: | Novel | Unique Identifier: | LAT016E11 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C14FH11O3 | Molecular Weight: | 235.146 g/mol | X log p: | 15.016 (online calculus) | Lipinksi Failures | 1 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 3 | Rotatable Bond Count: | 3 | Canonical Smiles: | Oc1ccc(c(O)c1)C(=O)Cc1ccc(F)cc1 |
Species: |
4932 |
Condition: |
pdr24h |
Replicates: |
2 |
Raw OD Value: r im |
0.7379±0.0137886 |
Normalized OD Score: sc h |
1.0340±0.00364218 |
Z-Score: |
1.5626±0.173541 |
p-Value: |
0.120909 |
Z-Factor: |
-1.4252 |
Fitness Defect: |
2.1127 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 16|E11 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.20 Celcius | Date: | 2007-03-08 YYYY-MM-DD | Plate CH Control (+): | 0.042425±0.00301 | Plate DMSO Control (-): | 0.69285±0.01648 | Plate Z-Factor: | 0.9190 |
| png ps pdf |
DBLink | Rows returned: 2 | |
2063467 |
1-(2,4-dihydroxyphenyl)-2-(4-fluorophenyl)ethanone |
5189895 |
2-(4-fluorophenyl)-1-(2,4,6-trihydroxyphenyl)ethanone |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 16963 | Additional Members: 14 | Rows returned: 6 | |
|