| Compound Information | SONAR Target prediction | | Name: | Novel | | Unique Identifier: | LAT016D06 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C14ClH11O3 | | Molecular Weight: | 251.601 g/mol | | X log p: | 15.477 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | Oc1ccc(c(O)c1)C(=O)Cc1cccc(Cl)c1 |
| Species: |
4932 |
| Condition: |
pdr18h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.1322±0.0384666 |
| Normalized OD Score: sc h |
0.2067±0.0550373 |
| Z-Score: |
-22.2329±0.1292 |
| p-Value: |
0 |
| Z-Factor: |
0.735402 |
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 16|D6 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.20 Celcius | | Date: | 2007-03-08 YYYY-MM-DD | | Plate CH Control (+): | 0.040999999999999995±0.00201 | | Plate DMSO Control (-): | 0.626275±0.00959 | | Plate Z-Factor: | 0.9432 |
|  png
ps
pdf |
| DBLink | Rows returned: 2 | |
| 689037 |
2-(3-chlorophenyl)-1-(2,4,6-trihydroxyphenyl)ethanone |
| 729356 |
2-(3-chlorophenyl)-1-(2,4-dihydroxyphenyl)ethanone |
| internal high similarity DBLink | Rows returned: 0 | |
|
