| Compound Information | SONAR Target prediction | | Name: | Novel | | Unique Identifier: | LAT016C09 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C16H16O5 | | Molecular Weight: | 272.168 g/mol | | X log p: | 13.507 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 35.53 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | COc1ccc(CC(=O)c2ccc(O)cc2O)cc1OC |
| Species: |
4932 |
| Condition: |
wt24h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7928±0.00452548 |
| Normalized OD Score: sc h |
0.9925±0.00638372 |
| Z-Score: |
-0.1248±0.0135222 |
| p-Value: |
0.900686 |
| Z-Factor: |
-7.83325 |
| Fitness Defect: |
0.1046 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 16|C9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.50 Celcius | | Date: | 2007-02-28 YYYY-MM-DD | | Plate CH Control (+): | 0.041025±0.03022 | | Plate DMSO Control (-): | 0.8028249999999999±0.01336 | | Plate Z-Factor: | 0.7014 |
|  png
ps
pdf |
| DBLink | Rows returned: 2 | |
| 689038 |
1-(2,4-dihydroxyphenyl)-2-(3,4-dimethoxyphenyl)ethanone |
| 804849 |
2-(3,4-dimethoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethanone |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 16963 | Additional Members: 14 | Rows returned: 6 | |
|
