Compound Information | SONAR Target prediction | Name: | Novel | Unique Identifier: | LAT016C09 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C16H16O5 | Molecular Weight: | 272.168 g/mol | X log p: | 13.507 (online calculus) | Lipinksi Failures | 1 | TPSA | 35.53 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 5 | Rotatable Bond Count: | 5 | Canonical Smiles: | COc1ccc(CC(=O)c2ccc(O)cc2O)cc1OC |
Species: |
4932 |
Condition: |
wt18h |
Replicates: |
2 |
Raw OD Value: r im |
0.8399±0.0106773 |
Normalized OD Score: sc h |
0.9875±0.0175112 |
Z-Score: |
-0.3385±0.579397 |
p-Value: |
0.698792 |
Z-Factor: |
-6.5111 |
Fitness Defect: |
0.3584 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 16|C9 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.50 Celcius | Date: | 2007-02-28 YYYY-MM-DD | Plate CH Control (+): | 0.039749999999999994±0.00219 | Plate DMSO Control (-): | 0.8140499999999999±0.01292 | Plate Z-Factor: | 0.9227 |
| png ps pdf |
DBLink | Rows returned: 2 | |
689038 |
1-(2,4-dihydroxyphenyl)-2-(3,4-dimethoxyphenyl)ethanone |
804849 |
2-(3,4-dimethoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethanone |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 16963 | Additional Members: 14 | Rows returned: 6 | |
|