| Compound Information | SONAR Target prediction | | Name: | Novel | | Unique Identifier: | LAT016C09 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C16H16O5 | | Molecular Weight: | 272.168 g/mol | | X log p: | 13.507 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 35.53 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 5 | | Rotatable Bond Count: | 5 | | Canonical Smiles: | COc1ccc(CC(=O)c2ccc(O)cc2O)cc1OC |
| Species: |
4932 |
| Condition: |
pdr24h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7200±0.0115258 |
| Normalized OD Score: sc h |
1.0115±0.0044074 |
| Z-Score: |
0.5940±0.183904 |
| p-Value: |
0.555882 |
| Z-Factor: |
-6.43235 |
| Fitness Defect: |
0.5872 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 16|C9 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.20 Celcius | | Date: | 2007-03-08 YYYY-MM-DD | | Plate CH Control (+): | 0.042425±0.00301 | | Plate DMSO Control (-): | 0.69285±0.01648 | | Plate Z-Factor: | 0.9190 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 689038 |
1-(2,4-dihydroxyphenyl)-2-(3,4-dimethoxyphenyl)ethanone |
| 804849 |
2-(3,4-dimethoxyphenyl)-1-(2,4,6-trihydroxyphenyl)ethanone |
| internal high similarity DBLink | Rows returned: 0 | |
|