| Compound Information | SONAR Target prediction | | Name: | Novel | | Unique Identifier: | LAT015C08 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C11F3H10NO3 | | Molecular Weight: | 251.118 g/mol | | X log p: | 9.181 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 26.3 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 4 | | Rotatable Bond Count: | 4 | | Canonical Smiles: | COc1ccc(c(O)c1)C(=O)C=C(N)C(F)(F)F |
| Species: |
4932 |
| Condition: |
wt18h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7366±0.0183848 |
| Normalized OD Score: sc h |
0.9651±0.00123122 |
| Z-Score: |
-0.9353±0.225948 |
| p-Value: |
0.35576 |
| Z-Factor: |
-0.299826 |
| Fitness Defect: |
1.0335 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 15|C8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.50 Celcius | | Date: | 2007-02-28 YYYY-MM-DD | | Plate CH Control (+): | 0.0395±0.00166 | | Plate DMSO Control (-): | 0.7961250000000001±0.01023 | | Plate Z-Factor: | 0.9609 |
|  png
ps
pdf |
| DBLink | Rows returned: 2 | |
| 872094 |
(E)-3-amino-4,4,4-trifluoro-1-(2-hydroxy-4-methoxy-phenyl)but-2-en-1-one |
| 2853011 |
3-amino-4,4,4-trifluoro-1-(2-hydroxy-4-methoxy-phenyl)but-2-en-1-one |
| internal high similarity DBLink | Rows returned: 1 | |
| active | Cluster 15651 | Additional Members: 8 | Rows returned: 3 | |
|
