Compound Information | SONAR Target prediction | Name: | Novel | Unique Identifier: | LAT015C08 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C11F3H10NO3 | Molecular Weight: | 251.118 g/mol | X log p: | 9.181 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 4 | Canonical Smiles: | COc1ccc(c(O)c1)C(=O)C=C(N)C(F)(F)F |
Species: |
4932 |
Condition: |
pdr22h |
Replicates: |
2 |
Raw OD Value: r im |
0.6888±0.0140714 |
Normalized OD Score: sc h |
1.0245±0.00983851 |
Z-Score: |
1.0407±0.413942 |
p-Value: |
0.318432 |
Z-Factor: |
-2.42935 |
Fitness Defect: |
1.1443 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 15|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.00 Celcius | Date: | 2007-03-08 YYYY-MM-DD | Plate CH Control (+): | 0.041675000000000004±0.00220 | Plate DMSO Control (-): | 0.6626000000000001±0.01352 | Plate Z-Factor: | 0.9278 |
| png ps pdf |
DBLink | Rows returned: 2 | |
872094 |
(E)-3-amino-4,4,4-trifluoro-1-(2-hydroxy-4-methoxy-phenyl)but-2-en-1-one |
2853011 |
3-amino-4,4,4-trifluoro-1-(2-hydroxy-4-methoxy-phenyl)but-2-en-1-one |
internal high similarity DBLink | Rows returned: 1 | |
active | Cluster 15651 | Additional Members: 8 | Rows returned: 3 | |
|