Compound Information | SONAR Target prediction | Name: | Novel | Unique Identifier: | LAT015C08 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C11F3H10NO3 | Molecular Weight: | 251.118 g/mol | X log p: | 9.181 (online calculus) | Lipinksi Failures | 1 | TPSA | 26.3 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 4 | Canonical Smiles: | COc1ccc(c(O)c1)C(=O)C=C(N)C(F)(F)F |
Species: |
4932 |
Condition: |
pdr18h |
Replicates: |
2 |
Raw OD Value: r im |
0.6325±0.00905097 |
Normalized OD Score: sc h |
1.0075±0.00477135 |
Z-Score: |
0.3589±0.15752 |
p-Value: |
0.72136 |
Z-Factor: |
-8.04091 |
Fitness Defect: |
0.3266 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 15|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.10 Celcius | Date: | 2007-03-08 YYYY-MM-DD | Plate CH Control (+): | 0.0413±0.00249 | Plate DMSO Control (-): | 0.6257±0.00813 | Plate Z-Factor: | 0.9576 |
| png ps pdf |
DBLink | Rows returned: 2 | |
872094 |
(E)-3-amino-4,4,4-trifluoro-1-(2-hydroxy-4-methoxy-phenyl)but-2-en-1-one |
2853011 |
3-amino-4,4,4-trifluoro-1-(2-hydroxy-4-methoxy-phenyl)but-2-en-1-one |
internal high similarity DBLink | Rows returned: 1 | |
nonactive | Cluster 15651 | Additional Members: 8 | Rows returned: 3 | |
|