| Compound Information | SONAR Target prediction | | Name: | Novel | | Unique Identifier: | LAT015B02 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C10Cl3H8NO2 | | Molecular Weight: | 272.471 g/mol | | X log p: | 11.257 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 3 | | Rotatable Bond Count: | 3 | | Canonical Smiles: | NC(=CC(=O)c1ccccc1O)C(Cl)(Cl)Cl |
| Species: |
4932 |
| Condition: |
pdr18h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.2382±0.02786 |
| Normalized OD Score: sc h |
0.3793±0.0407495 |
| Z-Score: |
-17.3694±0.165229 |
| p-Value: |
0 |
| Z-Factor: |
0.740937 |
| Fitness Defect: |
INF |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 15|B2 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.10 Celcius | | Date: | 2007-03-08 YYYY-MM-DD | | Plate CH Control (+): | 0.0413±0.00249 | | Plate DMSO Control (-): | 0.6257±0.00813 | | Plate Z-Factor: | 0.9576 |
| png ps pdf |
| DBLink | Rows returned: 2 | |
| 788049 |
(E)-3-amino-4,4,4-trichloro-1-(2-hydroxyphenyl)but-2-en-1-one |
| 2832881 |
3-amino-4,4,4-trichloro-1-(2-hydroxyphenyl)but-2-en-1-one |
| internal high similarity DBLink | Rows returned: 0 | |
| active | Cluster 15651 | Additional Members: 8 | Rows returned: 2 | |
|