| Compound Information | SONAR Target prediction | | Name: | Novel | | Unique Identifier: | LAT012E07 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C21ClH18N3O3 | | Molecular Weight: | 377.696 g/mol | | X log p: | 27.637 (online calculus) | | Lipinksi Failures | 1 | | TPSA | 34.14 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 6 | | Rotatable Bond Count: | 8 | | Canonical Smiles: | OC(C(=O)NNC(=O)Nc1cccc(Cl)c1)(c1ccccc1)c1ccccc1 |
| Species: |
4932 |
| Condition: |
pdr22h |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6923±0.0140007 |
| Normalized OD Score: sc h |
1.0359±0.00890073 |
| Z-Score: |
1.4913±0.3262 |
| p-Value: |
0.146249 |
| Z-Factor: |
-2.06476 |
| Fitness Defect: |
1.9224 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | LATCA | | Plate Number and Position: | 12|E7 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 27.00 Celcius | | Date: | 2007-03-08 YYYY-MM-DD | | Plate CH Control (+): | 0.0427±0.00298 | | Plate DMSO Control (-): | 0.66335±0.01962 | | Plate Z-Factor: | 0.8759 |
|  png
ps
pdf |
| DBLink | Rows returned: 1 | |
| 1358752 |
3-(3-chlorophenyl)-1-[(2-hydroxy-2,2-diphenyl-acetyl)amino]urea |
| internal high similarity DBLink | Rows returned: 1 | |
| nonactive | Cluster 13997 | Additional Members: 51 | Rows returned: 3 | |
|
