| Compound Information | SONAR Target prediction |
| Name: | Novel |
| Unique Identifier: | LAT011B08 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C14H12O3 |
| Molecular Weight: | 216.148 g/mol |
| X log p: | 8.768 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 35.53 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 3 |
| Rotatable Bond Count: | 1 |
| Canonical Smiles: | CC(=C)C1Cc2cc3C=CC(=O)Oc3cc2O1 |
| Found: 5 nonactive as graph: single | with analogs | 1 2 3 4 5 Next >> |
| Species: | 4932 |
| Condition: | pdr18h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.5853±0.0383959 |
| Normalized OD Score: sc h | 0.9744±0.0159905 |
| Z-Score: | -0.5670±0.404033 |
| p-Value: | 0.58614 |
| Z-Factor: | -2.96604 |
| Fitness Defect: | 0.5342 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 3 |
| 611672 |
| 759292 |
| 759293 |
| internal high similarity DBLink | Rows returned: 1 |
| CB 5648197 | 1.0000 |
| active | Cluster 302 | Additional Members: 10 | Rows returned: 4 |
| LAT001E05 | 0.533333333333333 |
| SPE00100543 | 0.533333333333333 |
| SPE01504164 | 0.485714285714286 |
| SPE00100540 | 0.456140350877193 |
Service provided by the
Mike Tyers Laboratory