Compound Information | SONAR Target prediction | Name: | Bucladesine Sodium Salt | Unique Identifier: | LAT007H04 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C18H23N5NaO8P | Molecular Weight: | 468.185 g/mol | X log p: | 2.342 (online calculus) | Lipinksi Failures | 1 | TPSA | 161.32 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 13 | Rotatable Bond Count: | 10 | Canonical Smiles: | [Na+].[O-]P1(=O)OC2C(COC(=O)CCC)OC(C2O1)n1cnc2c(NC(=O)CCC)ncnc12 |
Species: |
4932 |
Condition: |
wt24h |
Replicates: |
2 |
Raw OD Value: r im |
0.7880±0.0127279 |
Normalized OD Score: sc h |
0.9817±0.00625597 |
Z-Score: |
-0.6123±0.0918391 |
p-Value: |
0.541224 |
Z-Factor: |
-2.51527 |
Fitness Defect: |
0.6139 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | LATCA | Plate Number and Position: | 7|H4 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.40 Celcius | Date: | 2007-02-28 YYYY-MM-DD | Plate CH Control (+): | 0.040175±0.00236 | Plate DMSO Control (-): | 0.784825±0.01180 | Plate Z-Factor: | 0.9429 |
| png ps pdf |
DBLink | Rows returned: 2 | |
28177 |
sodium [(1R,2R,4R,5R)-2-[6-(butanoylamino)purin-9-yl]-7-oxido-7-oxo-3,6,8-trioxa-7$l^{5}-phosphabicyclo[3.3.0]o ct-4-yl]methyl butanoate |
28178 |
[(1R,5R,6R,8R)-6-[6-(butanoylamino)purin-9-yl]-3-hydroxy-3-oxo-2,4,7-trioxa-3$l^{5}-phosphabicyclo[3.3.0 ]oct-8-yl]methyl butanoate |
internal high similarity DBLink | Rows returned: 0 | |
active | Cluster 11040 | Additional Members: 3 | Rows returned: 0 | |
|