| Compound Information | SONAR Target prediction |
| Name: | Folic Acid |
| Unique Identifier: | LAT006H10 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C19H19N7O6 |
| Molecular Weight: | 422.247 g/mol |
| X log p: | 6.545 (online calculus) |
| Lipinksi Failures | 2 |
| TPSA | 105.36 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 13 |
| Rotatable Bond Count: | 10 |
| Canonical Smiles: | NC1NC(=O)c2nc(CNc3ccc(cc3)C(=O)NC(CCC(O)=O)C(O)=O)cnc2N=1 |
| Found: 5 nonactive as graph: single | with analogs | 1 2 3 4 5 Next >> |
| Species: | 4932 |
| Condition: | pdr18h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.5907±0.0326683 |
| Normalized OD Score: sc h | 0.9622±0.0173679 |
| Z-Score: | -0.9111±0.416919 |
| p-Value: | 0.38279 |
| Z-Factor: | -3.80526 |
| Fitness Defect: | 0.9603 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 0 |
| internal high similarity DBLink | Rows returned: 0 |
| active | Cluster 5590 | Additional Members: 8 | Rows returned: 1 |
| SPE01500679 | 0 |
Service provided by the
Mike Tyers Laboratory