| Compound Information | SONAR Target prediction |
| Name: | Clofibric Acid |
| Unique Identifier: | LAT006H06 |
| MolClass: | Checkout models in ver1.5 and ver1.0 |
| Molecular Formula: | C10ClH11O3 |
| Molecular Weight: | 203.558 g/mol |
| X log p: | 7.862 (online calculus) |
| Lipinksi Failures | 1 |
| TPSA | 26.3 |
| Hydrogen Bond Donor Count: | 0 |
| Hydrogen Bond Acceptors Count: | 3 |
| Rotatable Bond Count: | 3 |
| Canonical Smiles: | CC(C)(Oc1ccc(Cl)cc1)C(O)=O |
| Found: 5 nonactive as graph: single | with analogs | 1 2 3 4 5 Next >> |
| Species: | 4932 |
| Condition: | pdr18h |
| Replicates: | 2 |
| Raw OD Value: r im | 0.6054±0.0120915 |
| Normalized OD Score: sc h | 0.9784±0.0344043 |
| Z-Score: | -0.5064±1.0124 |
| p-Value: | 0.527844 |
| Z-Factor: | -14.502 |
| Fitness Defect: | 0.639 |
| Bioactivity Statement: | Nonactive |
| ps |
| DBLink | Rows returned: 15 | 1 2 3 Next >> |
| 2797 | 2-(4-chlorophenoxy)-2-methyl-propanoic acid |
| 18703 | 2-(4-chlorophenoxy)propanoic acid |
| 65611 | 2-(4-chlorophenoxy)-2-methyl-propanoate; magnesium(+2) cation |
| 68659 | calcium 2-(4-chlorophenoxy)-2-methyl-propanoate |
| 736071 | (2R)-2-(4-chlorophenoxy)propanoic acid |
| 736072 | (2S)-2-(4-chlorophenoxy)propanoic acid |
| internal high similarity DBLink | Rows returned: 3 |
| Prest39 | 1.0000 |
| SB 01597 | 1.0000 |
| SPE01500195 | 1.0000 |
| active | Cluster 16766 | Additional Members: 15 | Rows returned: 0 |
Service provided by the
Mike Tyers Laboratory